D-Aspartic acid α-t-butyl ester
Need Assistance?
  • US & Canada:
    +
  • UK: +

D-Aspartic acid α-t-butyl ester

* Please kindly note that our products are not to be used for therapeutic purposes and cannot be sold to patients.

Category
β−Amino Acids
Catalog number
BAT-005832
CAS number
148823-36-3
Molecular Formula
C8H15NO4
Molecular Weight
189.21
D-Aspartic acid α-t-butyl ester
IUPAC Name
(3R)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid
Synonyms
H-D-Asp-OtBu
Density
1.162±0.06 g/cm3
Boiling Point
297.8±30.0 °C
Storage
Store at-20°C
InChI
InChI=1S/C8H15NO4/c1-8(2,3)13-7(12)5(9)4-6(10)11/h5H,4,9H2,1-3H3,(H,10,11)/t5-/m1/s1
InChI Key
PUWCNJZIFKBDJQ-RXMQYKEDSA-N
Canonical SMILES
CC(C)(C)OC(=O)C(CC(=O)O)N

D-Aspartic acid α-t-butyl ester is a derivative of the amino acid D-aspartic acid. This compound is formed by the esterification of the α-carboxyl group of D-aspartic acid with a t-butyl group. The t-butyl esterification enhances the molecule’s lipophilicity, thus improving its ability to cross lipid membranes and be absorbed by the body more efficiently. This modification also protects the molecule from rapid metabolism, ultimately increasing its stability and bioavailability. D-Aspartic acid α-t-butyl ester is often researched for its potential applications in various fields including pharmaceuticals, nutrition, and biochemistry.

One of the primary applications of D-Aspartic acid α-t-butyl ester is in the field of pharmaceuticals, where it is explored for its potential role in drug delivery systems. The increased lipophilicity due to the t-butyl group allows this compound to enhance the delivery of drugs across cell membranes. This characteristic is particularly valuable in targeting drugs to specific cells or tissues, aiming to improve therapeutic outcomes while minimizing side effects. Additionally, its stability allows for a more controlled release of active agents over time, making it a promising candidate for developing novel drug formulations.

In the realm of nutrition and dietary supplements, D-Aspartic acid α-t-butyl ester is investigated for its role in hormone regulation and as a potential enhancer of athletic performance. The compound is thought to support the production and regulation of hormones such as testosterone by influencing the hypothalamic-pituitary-gonadal axis. This property makes it appealing to athletes and bodybuilders seeking to naturally enhance performance and muscle growth. Furthermore, due to its improved bioavailability, it may provide a more efficient supplement alternative compared to unmodified D-aspartic acid.

D-Aspartic acid α-t-butyl ester also finds applications in biochemical research, particularly in studies involving neurotransmitter regulation. As a derivative of D-aspartic acid, it is involved in the synthesis and release of neurotransmitters, which play a critical role in nervous system function. Researchers use this compound to study its effects on neural activity, synaptic plasticity, and cognitive functions, potentially providing insights into treatments for neurological disorders. This research is crucial in developing therapeutic strategies for conditions associated with neurotransmitter dysregulation.

Lastly, the compound is explored in the development of peptide-based drugs and cosmetics. In pharmaceuticals, its modification can help enhance the therapeutic profile of peptide drugs, improving their penetration and stability, leading to increased efficacy. In cosmetics, D-Aspartic acid α-t-butyl ester is studied for its potential to boost collagen production and skin regeneration due to its influence on cellular signaling pathways. Thus, its inclusion in skincare products may contribute to anti-aging and skin repair formulations, broadening its utility beyond traditional medicinal purposes.

Online Inquiry
Verification code
Inquiry Basket