L-Aspartic acid α,β-dibenzyl ester hydrochloride
Need Assistance?
  • US & Canada:
    +
  • UK: +

L-Aspartic acid α,β-dibenzyl ester hydrochloride

* Please kindly note that our products are not to be used for therapeutic purposes and cannot be sold to patients.

Category
β−Amino Acids
Catalog number
BAT-005856
CAS number
6327-59-9
Molecular Formula
C18H20ClNO4
Molecular Weight
349.81
L-Aspartic acid α,β-dibenzyl ester hydrochloride
IUPAC Name
dibenzyl (2S)-2-aminobutanedioate;hydrochloride
Synonyms
H-Asp(OBzl)-OBzl HCl
Density
1.205 g/cm3
Melting Point
124-125 °C
Boiling Point
455.3 °C
InChI
InChI=1S/C18H19NO4.ClH/c19-16(18(21)23-13-15-9-5-2-6-10-15)11-17(20)22-12-14-7-3-1-4-8-14;/h1-10,16H,11-13,19H2;1H/t16-;/m0./s1
InChI Key
ILBZEWOOBCRRAP-NTISSMGPSA-N
Canonical SMILES
C1=CC=C(C=C1)COC(=O)CC(C(=O)OCC2=CC=CC=C2)N.Cl

L-Aspartic acid α,β-dibenzyl ester hydrochloride is a synthetic derivative of aspartic acid, a naturally occurring amino acid primarily known for its role in the biosynthesis of proteins. Structurally, aspartic acid is characterized by the presence of a carboxylic acid functional group, which contributes to its classification as an acidic amino acid. The α,β-dibenzyl ester modification involves the esterification of both carboxyl groups of aspartic acid with benzyl alcohol, resulting in a compound with specific properties that can be used in specialized chemical applications. The hydrochloride salt form enhances its solubility and stability, making it suitable for various industrial and research purposes.

One of the key application areas of L-Aspartic acid α,β-dibenzyl ester hydrochloride is in the field of pharmaceuticals and drug development. It serves as an important intermediate in synthesizing active pharmaceutical ingredients (APIs) and other biologically active molecules. The esterified form allows for certain beneficial physicochemical properties, such as improved solubility and membrane permeability, which are crucial for the effective delivery of drugs in the body. Moreover, its synthetic versatility enables the introduction of various functional groups, facilitating the design and development of novel therapeutics targeting specific biochemical pathways.

In addition to pharmaceuticals, L-Aspartic acid α,β-dibenzyl ester hydrochloride finds application in peptide synthesis. As peptides gain traction as therapeutic agents due to their specificity and potency, the need for efficient and reliable synthesis methods becomes paramount. This compound is utilized as a protected form of aspartic acid during peptide synthesis, where the ester groups safeguard the carboxyl functionalities from undesired reactions. This protection is eventually removed in the later stages, yielding the desired peptide sequence with high purity and fidelity, which is essential for therapeutic applications.

Furthermore, the compound plays a significant role in the agrochemical industry. It is used as a building block for synthesizing various agrochemicals, including herbicides, fungicides, and insecticides. The presence of the reactive ester functionalities in L-Aspartic acid α,β-dibenzyl ester hydrochloride allows for modifications necessary to develop compounds with enhanced activity against pests and diseases, thus contributing to increased agricultural productivity. Its applicability in this sector underscores its importance in the development of sustainable agricultural practices.

Lastly, L-Aspartic acid α,β-dibenzyl ester hydrochloride is important in the synthesis of specialty polymers and advanced materials. The compound’s unique chemical structure allows it to be polymerized or copolymerized with other monomers to create materials with desired mechanical and chemical properties. These materials are employed in various industries, ranging from automotive to electronics, due to their high performance and durability. The compound’s role in tailoring material properties opens new avenues for innovation in material science, providing solutions to diverse industrial challenges.

Online Inquiry
Verification code
Inquiry Basket